C19H21FN2O3S2 — CID 60592003
(E)-1-[4-(2,5-dimethylthiophen-3-yl)sulfonylpiperazin-1-yl]-3-(3-fluorophenyl)prop-2-en-1-one (PubChem CID 60592003) has the molecular formula C19H21FN2O3S2 and a molecular weight of 408.52 g/mol. Its IUPAC name is (E)-1-[4-(2,5-dimethylthiophen-3-yl)sulfonylpiperazin-1-yl]-3-(3-fluorophenyl)prop-2-en-1-one.
| Compound Name | (E)-1-[4-(2,5-dimethylthiophen-3-yl)sulfonylpiperazin-1-yl]-3-(3-fluorophenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 60592003 |
| Molecular Formula | C19H21FN2O3S2 |
| Molecular Weight | 408.52 g/mol |
| Exact Mass | 408.10 |
| IUPAC Name | (E)-1-[4-(2,5-dimethylthiophen-3-yl)sulfonylpiperazin-1-yl]-3-(3-fluorophenyl)prop-2-en-1-one |
| SMILES | Cc1cc(S(=O)(=O)N2CCN(C(=O)/C=C/c3cccc(F)c3)CC2)c(C)s1 |
| InChI | InChI=1S/C19H21FN2O3S2/c1-14-12-18(15(2)26-14)27(24,25)22-10-8-21(9-11-22)19(23)7-6-16-4-3-5-17(20)13-16/h3-7,12-13H,8-11H2,1-2H3/b7-6+ |
| InChIKey | ZOURYBDDBSJSTN-VOTSOKGWSA-N |
| XLogP | 3.05 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.52 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|