C22H28N4O3 — CID 39633785
N-cyclopropyl-4-[(E)-3-[4-[2-(cyclopropylamino)-2-oxoethyl]piperazin-1-yl]-3-oxoprop-1-enyl]benzamide (PubChem CID 39633785) has the molecular formula C22H28N4O3 and a molecular weight of 396.49 g/mol. Its IUPAC name is N-cyclopropyl-4-[(E)-3-[4-[2-(cyclopropylamino)-2-oxoethyl]piperazin-1-yl]-3-oxoprop-1-enyl]benzamide.
| Compound Name | N-cyclopropyl-4-[(E)-3-[4-[2-(cyclopropylamino)-2-oxoethyl]piperazin-1-yl]-3-oxoprop-1-enyl]benzamide |
|---|---|
| PubChem CID | 39633785 |
| Molecular Formula | C22H28N4O3 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.22 |
| IUPAC Name | N-cyclopropyl-4-[(E)-3-[4-[2-(cyclopropylamino)-2-oxoethyl]piperazin-1-yl]-3-oxoprop-1-enyl]benzamide |
| SMILES | O=C(CN1CCN(C(=O)/C=C/c2ccc(C(=O)NC3CC3)cc2)CC1)NC1CC1 |
| InChI | InChI=1S/C22H28N4O3/c27-20(23-18-6-7-18)15-25-11-13-26(14-12-25)21(28)10-3-16-1-4-17(5-2-16)22(29)24-19-8-9-19/h1-5,10,18-19H,6-9,11-15H2,(H,23,27)(H,24,29)/b10-3+ |
| InChIKey | HZRZGZGMVZIJOC-XCVCLJGOSA-N |
| XLogP | 1.01 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|