C18H23N3O2 — CID 75535665
4-[(E)-3-[4-(cyclopropylmethyl)piperazin-1-yl]-3-oxoprop-1-enyl]benzamide (PubChem CID 75535665) has the molecular formula C18H23N3O2 and a molecular weight of 313.40 g/mol. Its IUPAC name is 4-[(E)-3-[4-(cyclopropylmethyl)piperazin-1-yl]-3-oxoprop-1-enyl]benzamide.
| Compound Name | 4-[(E)-3-[4-(cyclopropylmethyl)piperazin-1-yl]-3-oxoprop-1-enyl]benzamide |
|---|---|
| PubChem CID | 75535665 |
| Molecular Formula | C18H23N3O2 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.18 |
| IUPAC Name | 4-[(E)-3-[4-(cyclopropylmethyl)piperazin-1-yl]-3-oxoprop-1-enyl]benzamide |
| SMILES | NC(=O)c1ccc(/C=C/C(=O)N2CCN(CC3CC3)CC2)cc1 |
| InChI | InChI=1S/C18H23N3O2/c19-18(23)16-6-3-14(4-7-16)5-8-17(22)21-11-9-20(10-12-21)13-15-1-2-15/h3-8,15H,1-2,9-13H2,(H2,19,23)/b8-5+ |
| InChIKey | IEDHCJBWSPOBOI-VMPITWQZSA-N |
| XLogP | 1.35 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|