C22H26N4O3 — CID 39692507
N-cyclopropyl-4-[(E)-3-[4-[(3-methyl-1,2-oxazol-5-yl)methyl]piperazin-1-yl]-3-oxoprop-1-enyl]benzamide (PubChem CID 39692507) has the molecular formula C22H26N4O3 and a molecular weight of 394.48 g/mol. Its IUPAC name is N-cyclopropyl-4-[(E)-3-[4-[(3-methyl-1,2-oxazol-5-yl)methyl]piperazin-1-yl]-3-oxoprop-1-enyl]benzamide.
| Compound Name | N-cyclopropyl-4-[(E)-3-[4-[(3-methyl-1,2-oxazol-5-yl)methyl]piperazin-1-yl]-3-oxoprop-1-enyl]benzamide |
|---|---|
| PubChem CID | 39692507 |
| Molecular Formula | C22H26N4O3 |
| Molecular Weight | 394.48 g/mol |
| Exact Mass | 394.20 |
| IUPAC Name | N-cyclopropyl-4-[(E)-3-[4-[(3-methyl-1,2-oxazol-5-yl)methyl]piperazin-1-yl]-3-oxoprop-1-enyl]benzamide |
| SMILES | Cc1cc(CN2CCN(C(=O)/C=C/c3ccc(C(=O)NC4CC4)cc3)CC2)on1 |
| InChI | InChI=1S/C22H26N4O3/c1-16-14-20(29-24-16)15-25-10-12-26(13-11-25)21(27)9-4-17-2-5-18(6-3-17)22(28)23-19-7-8-19/h2-6,9,14,19H,7-8,10-13,15H2,1H3,(H,23,28)/b9-4+ |
| InChIKey | BWAFRSXBOMXGKG-RUDMXATFSA-N |
| XLogP | 2.23 |
| TPSA | 78.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.48 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|