C16H12N4O3S — CID 94844895
(E)-N'-(6-nitro-1,3-benzothiazol-2-yl)-3-phenylprop-2-enehydrazide (PubChem CID 94844895) has the molecular formula C16H12N4O3S and a molecular weight of 340.36 g/mol. Its IUPAC name is (E)-N'-(6-nitro-1,3-benzothiazol-2-yl)-3-phenylprop-2-enehydrazide.
| Compound Name | (E)-N'-(6-nitro-1,3-benzothiazol-2-yl)-3-phenylprop-2-enehydrazide |
|---|---|
| PubChem CID | 94844895 |
| Molecular Formula | C16H12N4O3S |
| Molecular Weight | 340.36 g/mol |
| Exact Mass | 340.06 |
| IUPAC Name | (E)-N'-(6-nitro-1,3-benzothiazol-2-yl)-3-phenylprop-2-enehydrazide |
| SMILES | O=C(/C=C/c1ccccc1)NNc1nc2ccc([N+](=O)[O-])cc2s1 |
| InChI | InChI=1S/C16H12N4O3S/c21-15(9-6-11-4-2-1-3-5-11)18-19-16-17-13-8-7-12(20(22)23)10-14(13)24-16/h1-10H,(H,17,19)(H,18,21)/b9-6+ |
| InChIKey | OPFAGIJAIALQFA-RMKNXTFCSA-N |
| XLogP | 3.36 |
| TPSA | 97.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.36 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|