C15H19N5O2S2 — CID 10270215
1-(6-nitro-1,3-benzothiazol-2-yl)-3-(2-piperidin-1-ylethyl)thiourea (PubChem CID 10270215) has the molecular formula C15H19N5O2S2 and a molecular weight of 365.48 g/mol. Its IUPAC name is 1-(6-nitro-1,3-benzothiazol-2-yl)-3-(2-piperidin-1-ylethyl)thiourea.
| Compound Name | 1-(6-nitro-1,3-benzothiazol-2-yl)-3-(2-piperidin-1-ylethyl)thiourea |
|---|---|
| PubChem CID | 10270215 |
| Molecular Formula | C15H19N5O2S2 |
| Molecular Weight | 365.48 g/mol |
| Exact Mass | 365.10 |
| IUPAC Name | 1-(6-nitro-1,3-benzothiazol-2-yl)-3-(2-piperidin-1-ylethyl)thiourea |
| SMILES | O=[N+]([O-])c1ccc2nc(NC(=S)NCCN3CCCCC3)sc2c1 |
| InChI | InChI=1S/C15H19N5O2S2/c21-20(22)11-4-5-12-13(10-11)24-15(17-12)18-14(23)16-6-9-19-7-2-1-3-8-19/h4-5,10H,1-3,6-9H2,(H2,16,17,18,23) |
| InChIKey | CJBVLWFZSLDOAK-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 83.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.48 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|