C18H22F17NO6Si — CID 87502411
2,3,3,3-tetrafluoro-2-[1,1,2,3,3,3-hexafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]-N-(3-triethoxysilylpropyl)propanamide (PubChem CID 87502411) has the molecular formula C18H22F17NO6Si and a molecular weight of 699.43 g/mol. Its IUPAC name is 2,3,3,3-tetrafluoro-2-[1,1,2,3,3,3-hexafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]-N-(3-triethoxysilylpropyl)propanamide.
| Compound Name | 2,3,3,3-tetrafluoro-2-[1,1,2,3,3,3-hexafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]-N-(3-triethoxysilylpropyl)propanamide |
|---|---|
| PubChem CID | 87502411 |
| Molecular Formula | C18H22F17NO6Si |
| Molecular Weight | 699.43 g/mol |
| Exact Mass | 699.09 |
| IUPAC Name | 2,3,3,3-tetrafluoro-2-[1,1,2,3,3,3-hexafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]-N-(3-triethoxysilylpropyl)propanamide |
| SMILES | CCO[Si](CCCNC(=O)C(F)(OC(F)(F)C(F)(OC(F)(F)C(F)(F)C(F)(F)F)C(F)(F)F)C(F)(F)F)(OCC)OCC |
| InChI | InChI=1S/C18H22F17NO6Si/c1-4-38-43(39-5-2,40-6-3)9-7-8-36-10(37)11(19,14(23,24)25)41-18(34,35)13(22,16(29,30)31)42-17(32,33)12(20,21)15(26,27)28/h4-9H2,1-3H3,(H,36,37) |
| InChIKey | ONBUOZZCNKNWEE-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 75.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 699.43 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|