C13H7F11N2O3 — CID 569628
N'-[2,3,3,3-tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propanoyl]benzohydrazide (PubChem CID 569628) has the molecular formula C13H7F11N2O3 and a molecular weight of 448.19 g/mol. Its IUPAC name is N'-[2,3,3,3-tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propanoyl]benzohydrazide.
| Compound Name | N'-[2,3,3,3-tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propanoyl]benzohydrazide |
|---|---|
| PubChem CID | 569628 |
| Molecular Formula | C13H7F11N2O3 |
| Molecular Weight | 448.19 g/mol |
| Exact Mass | 448.03 |
| IUPAC Name | N'-[2,3,3,3-tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propanoyl]benzohydrazide |
| SMILES | O=C(NNC(=O)C(F)(OC(F)(F)C(F)(F)C(F)(F)F)C(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C13H7F11N2O3/c14-9(11(17,18)19,29-13(23,24)10(15,16)12(20,21)22)8(28)26-25-7(27)6-4-2-1-3-5-6/h1-5H,(H,25,27)(H,26,28) |
| InChIKey | DWOQBPKUOUUUDC-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.19 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|