C15H7F13O4 — CID 102084358
4,5,5,5-tetrafluoro-4-[1,1,2,2,3,3-hexafluoro-3-(trifluoromethoxy)propoxy]-1-phenylpentane-1,3-dione (PubChem CID 102084358) has the molecular formula C15H7F13O4 and a molecular weight of 498.19 g/mol. Its IUPAC name is 4,5,5,5-tetrafluoro-4-[1,1,2,2,3,3-hexafluoro-3-(trifluoromethoxy)propoxy]-1-phenylpentane-1,3-dione.
| Compound Name | 4,5,5,5-tetrafluoro-4-[1,1,2,2,3,3-hexafluoro-3-(trifluoromethoxy)propoxy]-1-phenylpentane-1,3-dione |
|---|---|
| PubChem CID | 102084358 |
| Molecular Formula | C15H7F13O4 |
| Molecular Weight | 498.19 g/mol |
| Exact Mass | 498.01 |
| IUPAC Name | 4,5,5,5-tetrafluoro-4-[1,1,2,2,3,3-hexafluoro-3-(trifluoromethoxy)propoxy]-1-phenylpentane-1,3-dione |
| SMILES | O=C(CC(=O)C(F)(OC(F)(F)C(F)(F)C(F)(F)OC(F)(F)F)C(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C15H7F13O4/c16-10(12(19,20)21,9(30)6-8(29)7-4-2-1-3-5-7)31-13(22,23)11(17,18)14(24,25)32-15(26,27)28/h1-5H,6H2 |
| InChIKey | TUHZMJNKMCLJPF-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.19 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|