C9H4BrCl2NO — CID 130744415
3-bromo-N-(2,6-dichlorophenyl)prop-2-ynamide (PubChem CID 130744415) has the molecular formula C9H4BrCl2NO and a molecular weight of 292.95 g/mol. Its IUPAC name is 3-bromo-N-(2,6-dichlorophenyl)prop-2-ynamide.
| Compound Name | 3-bromo-N-(2,6-dichlorophenyl)prop-2-ynamide |
|---|---|
| PubChem CID | 130744415 |
| Molecular Formula | C9H4BrCl2NO |
| Molecular Weight | 292.95 g/mol |
| Exact Mass | 290.89 |
| IUPAC Name | 3-bromo-N-(2,6-dichlorophenyl)prop-2-ynamide |
| SMILES | O=C(C#CBr)Nc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C9H4BrCl2NO/c10-5-4-8(14)13-9-6(11)2-1-3-7(9)12/h1-3H,(H,13,14) |
| InChIKey | QURQEKUKVBXUSW-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.95 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|