C19H21FN2O4 — CID 18230812
ethyl 4-[[5-(2-fluorophenyl)furan-2-carbonyl]amino]piperidine-1-carboxylate (PubChem CID 18230812) has the molecular formula C19H21FN2O4 and a molecular weight of 360.39 g/mol. Its IUPAC name is ethyl 4-[[5-(2-fluorophenyl)furan-2-carbonyl]amino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[[5-(2-fluorophenyl)furan-2-carbonyl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 18230812 |
| Molecular Formula | C19H21FN2O4 |
| Molecular Weight | 360.39 g/mol |
| Exact Mass | 360.15 |
| IUPAC Name | ethyl 4-[[5-(2-fluorophenyl)furan-2-carbonyl]amino]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(NC(=O)c2ccc(-c3ccccc3F)o2)CC1 |
| InChI | InChI=1S/C19H21FN2O4/c1-2-25-19(24)22-11-9-13(10-12-22)21-18(23)17-8-7-16(26-17)14-5-3-4-6-15(14)20/h3-8,13H,2,9-12H2,1H3,(H,21,23) |
| InChIKey | SDRXEVNNDVGDGB-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 71.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.39 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |