C19H27N3O3 — CID 56893622
ethyl 4-[(2-pyrrolidin-3-ylbenzoyl)amino]piperidine-1-carboxylate (PubChem CID 56893622) has the molecular formula C19H27N3O3 and a molecular weight of 345.44 g/mol. Its IUPAC name is ethyl 4-[(2-pyrrolidin-3-ylbenzoyl)amino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[(2-pyrrolidin-3-ylbenzoyl)amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 56893622 |
| Molecular Formula | C19H27N3O3 |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.21 |
| IUPAC Name | ethyl 4-[(2-pyrrolidin-3-ylbenzoyl)amino]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(NC(=O)c2ccccc2C2CCNC2)CC1 |
| InChI | InChI=1S/C19H27N3O3/c1-2-25-19(24)22-11-8-15(9-12-22)21-18(23)17-6-4-3-5-16(17)14-7-10-20-13-14/h3-6,14-15,20H,2,7-13H2,1H3,(H,21,23) |
| InChIKey | ABBXOUKGYLHBGY-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |