C22H25ClN2O4 — CID 43010715
ethyl 4-[[2-[(4-chlorophenyl)methoxy]benzoyl]amino]piperidine-1-carboxylate (PubChem CID 43010715) has the molecular formula C22H25ClN2O4 and a molecular weight of 416.91 g/mol. Its IUPAC name is ethyl 4-[[2-[(4-chlorophenyl)methoxy]benzoyl]amino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[[2-[(4-chlorophenyl)methoxy]benzoyl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 43010715 |
| Molecular Formula | C22H25ClN2O4 |
| Molecular Weight | 416.91 g/mol |
| Exact Mass | 416.15 |
| IUPAC Name | ethyl 4-[[2-[(4-chlorophenyl)methoxy]benzoyl]amino]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(NC(=O)c2ccccc2OCc2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C22H25ClN2O4/c1-2-28-22(27)25-13-11-18(12-14-25)24-21(26)19-5-3-4-6-20(19)29-15-16-7-9-17(23)10-8-16/h3-10,18H,2,11-15H2,1H3,(H,24,26) |
| InChIKey | POZKMSASWQRZHW-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.91 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |