C19H23F3N2O2 — CID 78852684
2,5-dimethyl-1-(1-phenylethyl)-N-[2-(2,2,2-trifluoroethoxy)ethyl]pyrrole-3-carboxamide (PubChem CID 78852684) has the molecular formula C19H23F3N2O2 and a molecular weight of 368.40 g/mol. Its IUPAC name is 2,5-dimethyl-1-(1-phenylethyl)-N-[2-(2,2,2-trifluoroethoxy)ethyl]pyrrole-3-carboxamide.
| Compound Name | 2,5-dimethyl-1-(1-phenylethyl)-N-[2-(2,2,2-trifluoroethoxy)ethyl]pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 78852684 |
| Molecular Formula | C19H23F3N2O2 |
| Molecular Weight | 368.40 g/mol |
| Exact Mass | 368.17 |
| IUPAC Name | 2,5-dimethyl-1-(1-phenylethyl)-N-[2-(2,2,2-trifluoroethoxy)ethyl]pyrrole-3-carboxamide |
| SMILES | Cc1cc(C(=O)NCCOCC(F)(F)F)c(C)n1C(C)c1ccccc1 |
| InChI | InChI=1S/C19H23F3N2O2/c1-13-11-17(18(25)23-9-10-26-12-19(20,21)22)15(3)24(13)14(2)16-7-5-4-6-8-16/h4-8,11,14H,9-10,12H2,1-3H3,(H,23,25) |
| InChIKey | OTPVYOQIXDDSKG-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 43.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.40 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|