C17H17N3O2S — CID 134044519
2-(4-methyl-1,3-thiazol-5-yl)ethyl 1-benzylpyrazole-4-carboxylate (PubChem CID 134044519) has the molecular formula C17H17N3O2S and a molecular weight of 327.41 g/mol. Its IUPAC name is 2-(4-methyl-1,3-thiazol-5-yl)ethyl 1-benzylpyrazole-4-carboxylate.
| Compound Name | 2-(4-methyl-1,3-thiazol-5-yl)ethyl 1-benzylpyrazole-4-carboxylate |
|---|---|
| PubChem CID | 134044519 |
| Molecular Formula | C17H17N3O2S |
| Molecular Weight | 327.41 g/mol |
| Exact Mass | 327.10 |
| IUPAC Name | 2-(4-methyl-1,3-thiazol-5-yl)ethyl 1-benzylpyrazole-4-carboxylate |
| SMILES | Cc1ncsc1CCOC(=O)c1cnn(Cc2ccccc2)c1 |
| InChI | InChI=1S/C17H17N3O2S/c1-13-16(23-12-18-13)7-8-22-17(21)15-9-19-20(11-15)10-14-5-3-2-4-6-14/h2-6,9,11-12H,7-8,10H2,1H3 |
| InChIKey | ALKLRKWPHJOMMI-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.41 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |