C22H26N4O5S — CID 43961614
N-[2-(dimethylamino)ethyl]-N-(4,6-dimethyl-1,3-benzothiazol-2-yl)-4,5-dimethoxy-2-nitrobenzamide (PubChem CID 43961614) has the molecular formula C22H26N4O5S and a molecular weight of 458.54 g/mol. Its IUPAC name is N-[2-(dimethylamino)ethyl]-N-(4,6-dimethyl-1,3-benzothiazol-2-yl)-4,5-dimethoxy-2-nitrobenzamide.
| Compound Name | N-[2-(dimethylamino)ethyl]-N-(4,6-dimethyl-1,3-benzothiazol-2-yl)-4,5-dimethoxy-2-nitrobenzamide |
|---|---|
| PubChem CID | 43961614 |
| Molecular Formula | C22H26N4O5S |
| Molecular Weight | 458.54 g/mol |
| Exact Mass | 458.16 |
| IUPAC Name | N-[2-(dimethylamino)ethyl]-N-(4,6-dimethyl-1,3-benzothiazol-2-yl)-4,5-dimethoxy-2-nitrobenzamide |
| SMILES | COc1cc(C(=O)N(CCN(C)C)c2nc3c(C)cc(C)cc3s2)c([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C22H26N4O5S/c1-13-9-14(2)20-19(10-13)32-22(23-20)25(8-7-24(3)4)21(27)15-11-17(30-5)18(31-6)12-16(15)26(28)29/h9-12H,7-8H2,1-6H3 |
| InChIKey | CWLGNCOWRNKANO-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 98.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.54 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|