C21H25ClN4O3S — CID 44931026
N-[3-(dimethylamino)propyl]-N-(4,6-dimethyl-1,3-benzothiazol-2-yl)-3-nitrobenzamide;hydrochloride (PubChem CID 44931026) has the molecular formula C21H25ClN4O3S and a molecular weight of 448.98 g/mol. Its IUPAC name is N-[3-(dimethylamino)propyl]-N-(4,6-dimethyl-1,3-benzothiazol-2-yl)-3-nitrobenzamide;hydrochloride.
| Compound Name | N-[3-(dimethylamino)propyl]-N-(4,6-dimethyl-1,3-benzothiazol-2-yl)-3-nitrobenzamide;hydrochloride |
|---|---|
| PubChem CID | 44931026 |
| Molecular Formula | C21H25ClN4O3S |
| Molecular Weight | 448.98 g/mol |
| Exact Mass | 448.13 |
| IUPAC Name | N-[3-(dimethylamino)propyl]-N-(4,6-dimethyl-1,3-benzothiazol-2-yl)-3-nitrobenzamide;hydrochloride |
| SMILES | Cc1cc(C)c2nc(N(CCCN(C)C)C(=O)c3cccc([N+](=O)[O-])c3)sc2c1.Cl |
| InChI | InChI=1S/C21H24N4O3S.ClH/c1-14-11-15(2)19-18(12-14)29-21(22-19)24(10-6-9-23(3)4)20(26)16-7-5-8-17(13-16)25(27)28;/h5,7-8,11-13H,6,9-10H2,1-4H3;1H |
| InChIKey | RKNACEIQQPPEJF-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 79.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.98 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|