C21H24N4O3S — CID 43961512
N-[2-(dimethylamino)ethyl]-N-(4,6-dimethyl-1,3-benzothiazol-2-yl)-2-(4-nitrophenyl)acetamide (PubChem CID 43961512) has the molecular formula C21H24N4O3S and a molecular weight of 412.52 g/mol. Its IUPAC name is N-[2-(dimethylamino)ethyl]-N-(4,6-dimethyl-1,3-benzothiazol-2-yl)-2-(4-nitrophenyl)acetamide.
| Compound Name | N-[2-(dimethylamino)ethyl]-N-(4,6-dimethyl-1,3-benzothiazol-2-yl)-2-(4-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 43961512 |
| Molecular Formula | C21H24N4O3S |
| Molecular Weight | 412.52 g/mol |
| Exact Mass | 412.16 |
| IUPAC Name | N-[2-(dimethylamino)ethyl]-N-(4,6-dimethyl-1,3-benzothiazol-2-yl)-2-(4-nitrophenyl)acetamide |
| SMILES | Cc1cc(C)c2nc(N(CCN(C)C)C(=O)Cc3ccc([N+](=O)[O-])cc3)sc2c1 |
| InChI | InChI=1S/C21H24N4O3S/c1-14-11-15(2)20-18(12-14)29-21(22-20)24(10-9-23(3)4)19(26)13-16-5-7-17(8-6-16)25(27)28/h5-8,11-12H,9-10,13H2,1-4H3 |
| InChIKey | DJJUMSXHXGYRAM-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 79.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.52 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|