C22H25ClN4O3S — CID 43961523
N-(5-chloro-4-methyl-1,3-benzothiazol-2-yl)-N-[2-(diethylamino)ethyl]-2-(4-nitrophenyl)acetamide (PubChem CID 43961523) has the molecular formula C22H25ClN4O3S and a molecular weight of 460.99 g/mol. Its IUPAC name is N-(5-chloro-4-methyl-1,3-benzothiazol-2-yl)-N-[2-(diethylamino)ethyl]-2-(4-nitrophenyl)acetamide.
| Compound Name | N-(5-chloro-4-methyl-1,3-benzothiazol-2-yl)-N-[2-(diethylamino)ethyl]-2-(4-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 43961523 |
| Molecular Formula | C22H25ClN4O3S |
| Molecular Weight | 460.99 g/mol |
| Exact Mass | 460.13 |
| IUPAC Name | N-(5-chloro-4-methyl-1,3-benzothiazol-2-yl)-N-[2-(diethylamino)ethyl]-2-(4-nitrophenyl)acetamide |
| SMILES | CCN(CC)CCN(C(=O)Cc1ccc([N+](=O)[O-])cc1)c1nc2c(C)c(Cl)ccc2s1 |
| InChI | InChI=1S/C22H25ClN4O3S/c1-4-25(5-2)12-13-26(20(28)14-16-6-8-17(9-7-16)27(29)30)22-24-21-15(3)18(23)10-11-19(21)31-22/h6-11H,4-5,12-14H2,1-3H3 |
| InChIKey | HCQXLPBRNFFOGO-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 79.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.99 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|