C21H25ClN4O5S — CID 44931408
N-(4,7-dimethoxy-1,3-benzothiazol-2-yl)-N-[3-(dimethylamino)propyl]-2-nitrobenzamide;hydrochloride (PubChem CID 44931408) has the molecular formula C21H25ClN4O5S and a molecular weight of 480.97 g/mol. Its IUPAC name is N-(4,7-dimethoxy-1,3-benzothiazol-2-yl)-N-[3-(dimethylamino)propyl]-2-nitrobenzamide;hydrochloride.
| Compound Name | N-(4,7-dimethoxy-1,3-benzothiazol-2-yl)-N-[3-(dimethylamino)propyl]-2-nitrobenzamide;hydrochloride |
|---|---|
| PubChem CID | 44931408 |
| Molecular Formula | C21H25ClN4O5S |
| Molecular Weight | 480.97 g/mol |
| Exact Mass | 480.12 |
| IUPAC Name | N-(4,7-dimethoxy-1,3-benzothiazol-2-yl)-N-[3-(dimethylamino)propyl]-2-nitrobenzamide;hydrochloride |
| SMILES | COc1ccc(OC)c2sc(N(CCCN(C)C)C(=O)c3ccccc3[N+](=O)[O-])nc12.Cl |
| InChI | InChI=1S/C21H24N4O5S.ClH/c1-23(2)12-7-13-24(20(26)14-8-5-6-9-15(14)25(27)28)21-22-18-16(29-3)10-11-17(30-4)19(18)31-21;/h5-6,8-11H,7,12-13H2,1-4H3;1H |
| InChIKey | IEUGXRQNAZALSB-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 98.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.97 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|