C21H23ClN4O3S — CID 43964735
N-(7-chloro-4-methyl-1,3-benzothiazol-2-yl)-N-[3-(dimethylamino)propyl]-2-methyl-3-nitrobenzamide (PubChem CID 43964735) has the molecular formula C21H23ClN4O3S and a molecular weight of 446.96 g/mol. Its IUPAC name is N-(7-chloro-4-methyl-1,3-benzothiazol-2-yl)-N-[3-(dimethylamino)propyl]-2-methyl-3-nitrobenzamide.
| Compound Name | N-(7-chloro-4-methyl-1,3-benzothiazol-2-yl)-N-[3-(dimethylamino)propyl]-2-methyl-3-nitrobenzamide |
|---|---|
| PubChem CID | 43964735 |
| Molecular Formula | C21H23ClN4O3S |
| Molecular Weight | 446.96 g/mol |
| Exact Mass | 446.12 |
| IUPAC Name | N-(7-chloro-4-methyl-1,3-benzothiazol-2-yl)-N-[3-(dimethylamino)propyl]-2-methyl-3-nitrobenzamide |
| SMILES | Cc1c(C(=O)N(CCCN(C)C)c2nc3c(C)ccc(Cl)c3s2)cccc1[N+](=O)[O-] |
| InChI | InChI=1S/C21H23ClN4O3S/c1-13-9-10-16(22)19-18(13)23-21(30-19)25(12-6-11-24(3)4)20(27)15-7-5-8-17(14(15)2)26(28)29/h5,7-10H,6,11-12H2,1-4H3 |
| InChIKey | HCCJJYAEQNTMLX-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 79.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.96 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|