C19H23ClN4O4S2 — CID 44925897
N-[2-(diethylamino)ethyl]-N-(4-methoxy-1,3-benzothiazol-2-yl)-5-nitrothiophene-2-carboxamide;hydrochloride (PubChem CID 44925897) has the molecular formula C19H23ClN4O4S2 and a molecular weight of 471.00 g/mol. Its IUPAC name is N-[2-(diethylamino)ethyl]-N-(4-methoxy-1,3-benzothiazol-2-yl)-5-nitrothiophene-2-carboxamide;hydrochloride.
| Compound Name | N-[2-(diethylamino)ethyl]-N-(4-methoxy-1,3-benzothiazol-2-yl)-5-nitrothiophene-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 44925897 |
| Molecular Formula | C19H23ClN4O4S2 |
| Molecular Weight | 471.00 g/mol |
| Exact Mass | 470.08 |
| IUPAC Name | N-[2-(diethylamino)ethyl]-N-(4-methoxy-1,3-benzothiazol-2-yl)-5-nitrothiophene-2-carboxamide;hydrochloride |
| SMILES | CCN(CC)CCN(C(=O)c1ccc([N+](=O)[O-])s1)c1nc2c(OC)cccc2s1.Cl |
| InChI | InChI=1S/C19H22N4O4S2.ClH/c1-4-21(5-2)11-12-22(18(24)15-9-10-16(28-15)23(25)26)19-20-17-13(27-3)7-6-8-14(17)29-19;/h6-10H,4-5,11-12H2,1-3H3;1H |
| InChIKey | QWVKQPOZBDJUAZ-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 88.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.00 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|