C19H22N4O5S2 — CID 41348033
N-(5,6-dimethoxy-1,3-benzothiazol-2-yl)-N-[3-(dimethylamino)propyl]-5-nitrothiophene-2-carboxamide (PubChem CID 41348033) has the molecular formula C19H22N4O5S2 and a molecular weight of 450.54 g/mol. Its IUPAC name is N-(5,6-dimethoxy-1,3-benzothiazol-2-yl)-N-[3-(dimethylamino)propyl]-5-nitrothiophene-2-carboxamide.
| Compound Name | N-(5,6-dimethoxy-1,3-benzothiazol-2-yl)-N-[3-(dimethylamino)propyl]-5-nitrothiophene-2-carboxamide |
|---|---|
| PubChem CID | 41348033 |
| Molecular Formula | C19H22N4O5S2 |
| Molecular Weight | 450.54 g/mol |
| Exact Mass | 450.10 |
| IUPAC Name | N-(5,6-dimethoxy-1,3-benzothiazol-2-yl)-N-[3-(dimethylamino)propyl]-5-nitrothiophene-2-carboxamide |
| SMILES | COc1cc2nc(N(CCCN(C)C)C(=O)c3ccc([N+](=O)[O-])s3)sc2cc1OC |
| InChI | InChI=1S/C19H22N4O5S2/c1-21(2)8-5-9-22(18(24)15-6-7-17(29-15)23(25)26)19-20-12-10-13(27-3)14(28-4)11-16(12)30-19/h6-7,10-11H,5,8-9H2,1-4H3 |
| InChIKey | HCZALKSFOHDPBQ-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 98.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.54 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|