C18H20N4O4S2 — CID 41348131
N-[3-(dimethylamino)propyl]-N-(5-methoxy-1,3-benzothiazol-2-yl)-5-nitrothiophene-2-carboxamide (PubChem CID 41348131) has the molecular formula C18H20N4O4S2 and a molecular weight of 420.52 g/mol. Its IUPAC name is N-[3-(dimethylamino)propyl]-N-(5-methoxy-1,3-benzothiazol-2-yl)-5-nitrothiophene-2-carboxamide.
| Compound Name | N-[3-(dimethylamino)propyl]-N-(5-methoxy-1,3-benzothiazol-2-yl)-5-nitrothiophene-2-carboxamide |
|---|---|
| PubChem CID | 41348131 |
| Molecular Formula | C18H20N4O4S2 |
| Molecular Weight | 420.52 g/mol |
| Exact Mass | 420.09 |
| IUPAC Name | N-[3-(dimethylamino)propyl]-N-(5-methoxy-1,3-benzothiazol-2-yl)-5-nitrothiophene-2-carboxamide |
| SMILES | COc1ccc2sc(N(CCCN(C)C)C(=O)c3ccc([N+](=O)[O-])s3)nc2c1 |
| InChI | InChI=1S/C18H20N4O4S2/c1-20(2)9-4-10-21(17(23)15-7-8-16(27-15)22(24)25)18-19-13-11-12(26-3)5-6-14(13)28-18/h5-8,11H,4,9-10H2,1-3H3 |
| InChIKey | QGFCIRRGFQDZKQ-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 88.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.52 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|