C20H19N5O6S — CID 29137430
N-(1,3-benzothiazol-2-yl)-N-(2-morpholin-4-ylethyl)-3,5-dinitrobenzamide (PubChem CID 29137430) has the molecular formula C20H19N5O6S and a molecular weight of 457.47 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-yl)-N-(2-morpholin-4-ylethyl)-3,5-dinitrobenzamide.
| Compound Name | N-(1,3-benzothiazol-2-yl)-N-(2-morpholin-4-ylethyl)-3,5-dinitrobenzamide |
|---|---|
| PubChem CID | 29137430 |
| Molecular Formula | C20H19N5O6S |
| Molecular Weight | 457.47 g/mol |
| Exact Mass | 457.11 |
| IUPAC Name | N-(1,3-benzothiazol-2-yl)-N-(2-morpholin-4-ylethyl)-3,5-dinitrobenzamide |
| SMILES | O=C(c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1)N(CCN1CCOCC1)c1nc2ccccc2s1 |
| InChI | InChI=1S/C20H19N5O6S/c26-19(14-11-15(24(27)28)13-16(12-14)25(29)30)23(6-5-22-7-9-31-10-8-22)20-21-17-3-1-2-4-18(17)32-20/h1-4,11-13H,5-10H2 |
| InChIKey | SBGDMMPHIYDGQW-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 131.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.47 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|