C21H23ClN4O6S2 — CID 44947891
N-(6-methylsulfonyl-1,3-benzothiazol-2-yl)-N-(2-morpholin-4-ylethyl)-3-nitrobenzamide;hydrochloride (PubChem CID 44947891) has the molecular formula C21H23ClN4O6S2 and a molecular weight of 527.02 g/mol. Its IUPAC name is N-(6-methylsulfonyl-1,3-benzothiazol-2-yl)-N-(2-morpholin-4-ylethyl)-3-nitrobenzamide;hydrochloride.
| Compound Name | N-(6-methylsulfonyl-1,3-benzothiazol-2-yl)-N-(2-morpholin-4-ylethyl)-3-nitrobenzamide;hydrochloride |
|---|---|
| PubChem CID | 44947891 |
| Molecular Formula | C21H23ClN4O6S2 |
| Molecular Weight | 527.02 g/mol |
| Exact Mass | 526.07 |
| IUPAC Name | N-(6-methylsulfonyl-1,3-benzothiazol-2-yl)-N-(2-morpholin-4-ylethyl)-3-nitrobenzamide;hydrochloride |
| SMILES | CS(=O)(=O)c1ccc2nc(N(CCN3CCOCC3)C(=O)c3cccc([N+](=O)[O-])c3)sc2c1.Cl |
| InChI | InChI=1S/C21H22N4O6S2.ClH/c1-33(29,30)17-5-6-18-19(14-17)32-21(22-18)24(8-7-23-9-11-31-12-10-23)20(26)15-3-2-4-16(13-15)25(27)28;/h2-6,13-14H,7-12H2,1H3;1H |
| InChIKey | HQVIIIZOHAWFQG-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 122.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.02 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|