C22H24N4O4S — CID 18583062
N-(4-ethyl-1,3-benzothiazol-2-yl)-N-(2-morpholin-4-ylethyl)-4-nitrobenzamide (PubChem CID 18583062) has the molecular formula C22H24N4O4S and a molecular weight of 440.53 g/mol. Its IUPAC name is N-(4-ethyl-1,3-benzothiazol-2-yl)-N-(2-morpholin-4-ylethyl)-4-nitrobenzamide.
| Compound Name | N-(4-ethyl-1,3-benzothiazol-2-yl)-N-(2-morpholin-4-ylethyl)-4-nitrobenzamide |
|---|---|
| PubChem CID | 18583062 |
| Molecular Formula | C22H24N4O4S |
| Molecular Weight | 440.53 g/mol |
| Exact Mass | 440.15 |
| IUPAC Name | N-(4-ethyl-1,3-benzothiazol-2-yl)-N-(2-morpholin-4-ylethyl)-4-nitrobenzamide |
| SMILES | CCc1cccc2sc(N(CCN3CCOCC3)C(=O)c3ccc([N+](=O)[O-])cc3)nc12 |
| InChI | InChI=1S/C22H24N4O4S/c1-2-16-4-3-5-19-20(16)23-22(31-19)25(11-10-24-12-14-30-15-13-24)21(27)17-6-8-18(9-7-17)26(28)29/h3-9H,2,10-15H2,1H3 |
| InChIKey | PLIIJIWTALMXHQ-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 88.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.53 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|