C28H32N4O3S3 — CID 44944417
4-(dibutylsulfamoyl)-N-(6-methyl-1,3-benzothiazol-2-yl)-N-[(E)-thiophen-2-ylmethylideneamino]benzamide (PubChem CID 44944417) has the molecular formula C28H32N4O3S3 and a molecular weight of 568.79 g/mol. Its IUPAC name is 4-(dibutylsulfamoyl)-N-(6-methyl-1,3-benzothiazol-2-yl)-N-[(E)-thiophen-2-ylmethylideneamino]benzamide.
| Compound Name | 4-(dibutylsulfamoyl)-N-(6-methyl-1,3-benzothiazol-2-yl)-N-[(E)-thiophen-2-ylmethylideneamino]benzamide |
|---|---|
| PubChem CID | 44944417 |
| Molecular Formula | C28H32N4O3S3 |
| Molecular Weight | 568.79 g/mol |
| Exact Mass | 568.16 |
| IUPAC Name | 4-(dibutylsulfamoyl)-N-(6-methyl-1,3-benzothiazol-2-yl)-N-[(E)-thiophen-2-ylmethylideneamino]benzamide |
| SMILES | CCCCN(CCCC)S(=O)(=O)c1ccc(C(=O)N(/N=C/c2cccs2)c2nc3ccc(C)cc3s2)cc1 |
| InChI | InChI=1S/C28H32N4O3S3/c1-4-6-16-31(17-7-5-2)38(34,35)24-13-11-22(12-14-24)27(33)32(29-20-23-9-8-18-36-23)28-30-25-15-10-21(3)19-26(25)37-28/h8-15,18-20H,4-7,16-17H2,1-3H3/b29-20+ |
| InChIKey | YPTYXHFRGIKEGM-ZTKZIYFRSA-N |
| XLogP | 6.94 |
| TPSA | 82.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.79 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|