C25H25FN4O5S3 — CID 44943217
4-[bis(2-methoxyethyl)sulfamoyl]-N-(6-fluoro-1,3-benzothiazol-2-yl)-N-[(E)-thiophen-2-ylmethylideneamino]benzamide (PubChem CID 44943217) has the molecular formula C25H25FN4O5S3 and a molecular weight of 576.70 g/mol. Its IUPAC name is 4-[bis(2-methoxyethyl)sulfamoyl]-N-(6-fluoro-1,3-benzothiazol-2-yl)-N-[(E)-thiophen-2-ylmethylideneamino]benzamide.
| Compound Name | 4-[bis(2-methoxyethyl)sulfamoyl]-N-(6-fluoro-1,3-benzothiazol-2-yl)-N-[(E)-thiophen-2-ylmethylideneamino]benzamide |
|---|---|
| PubChem CID | 44943217 |
| Molecular Formula | C25H25FN4O5S3 |
| Molecular Weight | 576.70 g/mol |
| Exact Mass | 576.10 |
| IUPAC Name | 4-[bis(2-methoxyethyl)sulfamoyl]-N-(6-fluoro-1,3-benzothiazol-2-yl)-N-[(E)-thiophen-2-ylmethylideneamino]benzamide |
| SMILES | COCCN(CCOC)S(=O)(=O)c1ccc(C(=O)N(/N=C/c2cccs2)c2nc3ccc(F)cc3s2)cc1 |
| InChI | InChI=1S/C25H25FN4O5S3/c1-34-13-11-29(12-14-35-2)38(32,33)21-8-5-18(6-9-21)24(31)30(27-17-20-4-3-15-36-20)25-28-22-10-7-19(26)16-23(22)37-25/h3-10,15-17H,11-14H2,1-2H3/b27-17+ |
| InChIKey | GVVLZHUCWOBNDJ-WPWMEQJKSA-N |
| XLogP | 4.46 |
| TPSA | 101.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.70 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|