C23H14ClFN4O3S — CID 44943373
(E)-3-(2-chlorophenyl)-N-(6-fluoro-1,3-benzothiazol-2-yl)-N-[(E)-(4-nitrophenyl)methylideneamino]prop-2-enamide (PubChem CID 44943373) has the molecular formula C23H14ClFN4O3S and a molecular weight of 480.91 g/mol. Its IUPAC name is (E)-3-(2-chlorophenyl)-N-(6-fluoro-1,3-benzothiazol-2-yl)-N-[(E)-(4-nitrophenyl)methylideneamino]prop-2-enamide.
| Compound Name | (E)-3-(2-chlorophenyl)-N-(6-fluoro-1,3-benzothiazol-2-yl)-N-[(E)-(4-nitrophenyl)methylideneamino]prop-2-enamide |
|---|---|
| PubChem CID | 44943373 |
| Molecular Formula | C23H14ClFN4O3S |
| Molecular Weight | 480.91 g/mol |
| Exact Mass | 480.05 |
| IUPAC Name | (E)-3-(2-chlorophenyl)-N-(6-fluoro-1,3-benzothiazol-2-yl)-N-[(E)-(4-nitrophenyl)methylideneamino]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccccc1Cl)N(/N=C/c1ccc([N+](=O)[O-])cc1)c1nc2ccc(F)cc2s1 |
| InChI | InChI=1S/C23H14ClFN4O3S/c24-19-4-2-1-3-16(19)7-12-22(30)28(23-27-20-11-8-17(25)13-21(20)33-23)26-14-15-5-9-18(10-6-15)29(31)32/h1-14H/b12-7+,26-14+ |
| InChIKey | FTXZDLXXZRCAGZ-HKZPUGLOSA-N |
| XLogP | 6.08 |
| TPSA | 88.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.91 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|