C19H11ClFN3OS2 — CID 44942714
N-[(E)-benzylideneamino]-5-chloro-N-(6-fluoro-1,3-benzothiazol-2-yl)thiophene-2-carboxamide (PubChem CID 44942714) has the molecular formula C19H11ClFN3OS2 and a molecular weight of 415.90 g/mol. Its IUPAC name is N-[(E)-benzylideneamino]-5-chloro-N-(6-fluoro-1,3-benzothiazol-2-yl)thiophene-2-carboxamide.
| Compound Name | N-[(E)-benzylideneamino]-5-chloro-N-(6-fluoro-1,3-benzothiazol-2-yl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 44942714 |
| Molecular Formula | C19H11ClFN3OS2 |
| Molecular Weight | 415.90 g/mol |
| Exact Mass | 415.00 |
| IUPAC Name | N-[(E)-benzylideneamino]-5-chloro-N-(6-fluoro-1,3-benzothiazol-2-yl)thiophene-2-carboxamide |
| SMILES | O=C(c1ccc(Cl)s1)N(/N=C/c1ccccc1)c1nc2ccc(F)cc2s1 |
| InChI | InChI=1S/C19H11ClFN3OS2/c20-17-9-8-15(26-17)18(25)24(22-11-12-4-2-1-3-5-12)19-23-14-7-6-13(21)10-16(14)27-19/h1-11H/b22-11+ |
| InChIKey | NOGUXIHIXRJPKM-SSDVNMTOSA-N |
| XLogP | 5.83 |
| TPSA | 45.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.90 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|