C28H22BrN5O5S3 — CID 44942470
4-[benzyl(ethyl)sulfamoyl]-N-(6-bromo-1,3-benzothiazol-2-yl)-N-[(E)-(5-nitrothiophen-2-yl)methylideneamino]benzamide (PubChem CID 44942470) has the molecular formula C28H22BrN5O5S3 and a molecular weight of 684.62 g/mol. Its IUPAC name is 4-[benzyl(ethyl)sulfamoyl]-N-(6-bromo-1,3-benzothiazol-2-yl)-N-[(E)-(5-nitrothiophen-2-yl)methylideneamino]benzamide.
| Compound Name | 4-[benzyl(ethyl)sulfamoyl]-N-(6-bromo-1,3-benzothiazol-2-yl)-N-[(E)-(5-nitrothiophen-2-yl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 44942470 |
| Molecular Formula | C28H22BrN5O5S3 |
| Molecular Weight | 684.62 g/mol |
| Exact Mass | 683.00 |
| IUPAC Name | 4-[benzyl(ethyl)sulfamoyl]-N-(6-bromo-1,3-benzothiazol-2-yl)-N-[(E)-(5-nitrothiophen-2-yl)methylideneamino]benzamide |
| SMILES | CCN(Cc1ccccc1)S(=O)(=O)c1ccc(C(=O)N(/N=C/c2ccc([N+](=O)[O-])s2)c2nc3ccc(Br)cc3s2)cc1 |
| InChI | InChI=1S/C28H22BrN5O5S3/c1-2-32(18-19-6-4-3-5-7-19)42(38,39)23-12-8-20(9-13-23)27(35)33(30-17-22-11-15-26(40-22)34(36)37)28-31-24-14-10-21(29)16-25(24)41-28/h3-17H,2,18H2,1H3/b30-17+ |
| InChIKey | GVBQKBKGFRXQIF-OCSSWDANSA-N |
| XLogP | 6.92 |
| TPSA | 126.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.62 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|