C21H15BrN4O3S3 — CID 44942479
N-(6-bromo-1,3-benzothiazol-2-yl)-N-[(E)-(5-nitrothiophen-2-yl)methylideneamino]-3-phenylsulfanylpropanamide (PubChem CID 44942479) has the molecular formula C21H15BrN4O3S3 and a molecular weight of 547.48 g/mol. Its IUPAC name is N-(6-bromo-1,3-benzothiazol-2-yl)-N-[(E)-(5-nitrothiophen-2-yl)methylideneamino]-3-phenylsulfanylpropanamide.
| Compound Name | N-(6-bromo-1,3-benzothiazol-2-yl)-N-[(E)-(5-nitrothiophen-2-yl)methylideneamino]-3-phenylsulfanylpropanamide |
|---|---|
| PubChem CID | 44942479 |
| Molecular Formula | C21H15BrN4O3S3 |
| Molecular Weight | 547.48 g/mol |
| Exact Mass | 545.95 |
| IUPAC Name | N-(6-bromo-1,3-benzothiazol-2-yl)-N-[(E)-(5-nitrothiophen-2-yl)methylideneamino]-3-phenylsulfanylpropanamide |
| SMILES | O=C(CCSc1ccccc1)N(/N=C/c1ccc([N+](=O)[O-])s1)c1nc2ccc(Br)cc2s1 |
| InChI | InChI=1S/C21H15BrN4O3S3/c22-14-6-8-17-18(12-14)32-21(24-17)25(23-13-16-7-9-20(31-16)26(28)29)19(27)10-11-30-15-4-2-1-3-5-15/h1-9,12-13H,10-11H2/b23-13+ |
| InChIKey | FIXBMEBPANCBOX-YDZHTSKRSA-N |
| XLogP | 6.58 |
| TPSA | 88.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.48 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|