C23H14BrN5O5S2 — CID 44942440
N-(6-bromo-1,3-benzothiazol-2-yl)-3-(2,5-dioxopyrrolidin-1-yl)-N-[(E)-(5-nitrothiophen-2-yl)methylideneamino]benzamide (PubChem CID 44942440) has the molecular formula C23H14BrN5O5S2 and a molecular weight of 584.43 g/mol. Its IUPAC name is N-(6-bromo-1,3-benzothiazol-2-yl)-3-(2,5-dioxopyrrolidin-1-yl)-N-[(E)-(5-nitrothiophen-2-yl)methylideneamino]benzamide.
| Compound Name | N-(6-bromo-1,3-benzothiazol-2-yl)-3-(2,5-dioxopyrrolidin-1-yl)-N-[(E)-(5-nitrothiophen-2-yl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 44942440 |
| Molecular Formula | C23H14BrN5O5S2 |
| Molecular Weight | 584.43 g/mol |
| Exact Mass | 582.96 |
| IUPAC Name | N-(6-bromo-1,3-benzothiazol-2-yl)-3-(2,5-dioxopyrrolidin-1-yl)-N-[(E)-(5-nitrothiophen-2-yl)methylideneamino]benzamide |
| SMILES | O=C(c1cccc(N2C(=O)CCC2=O)c1)N(/N=C/c1ccc([N+](=O)[O-])s1)c1nc2ccc(Br)cc2s1 |
| InChI | InChI=1S/C23H14BrN5O5S2/c24-14-4-6-17-18(11-14)36-23(26-17)28(25-12-16-5-9-21(35-16)29(33)34)22(32)13-2-1-3-15(10-13)27-19(30)7-8-20(27)31/h1-6,9-12H,7-8H2/b25-12+ |
| InChIKey | PUDPDGALIKNEHH-BRJLIKDPSA-N |
| XLogP | 5.36 |
| TPSA | 126.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.43 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|