C29H24FN5O6S2 — CID 44943798
4-[benzyl(propan-2-yl)sulfamoyl]-N-(6-fluoro-1,3-benzothiazol-2-yl)-N-[(E)-(5-nitrofuran-2-yl)methylideneamino]benzamide (PubChem CID 44943798) has the molecular formula C29H24FN5O6S2 and a molecular weight of 621.67 g/mol. Its IUPAC name is 4-[benzyl(propan-2-yl)sulfamoyl]-N-(6-fluoro-1,3-benzothiazol-2-yl)-N-[(E)-(5-nitrofuran-2-yl)methylideneamino]benzamide.
| Compound Name | 4-[benzyl(propan-2-yl)sulfamoyl]-N-(6-fluoro-1,3-benzothiazol-2-yl)-N-[(E)-(5-nitrofuran-2-yl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 44943798 |
| Molecular Formula | C29H24FN5O6S2 |
| Molecular Weight | 621.67 g/mol |
| Exact Mass | 621.12 |
| IUPAC Name | 4-[benzyl(propan-2-yl)sulfamoyl]-N-(6-fluoro-1,3-benzothiazol-2-yl)-N-[(E)-(5-nitrofuran-2-yl)methylideneamino]benzamide |
| SMILES | CC(C)N(Cc1ccccc1)S(=O)(=O)c1ccc(C(=O)N(/N=C/c2ccc([N+](=O)[O-])o2)c2nc3ccc(F)cc3s2)cc1 |
| InChI | InChI=1S/C29H24FN5O6S2/c1-19(2)33(18-20-6-4-3-5-7-20)43(39,40)24-12-8-21(9-13-24)28(36)34(31-17-23-11-15-27(41-23)35(37)38)29-32-25-14-10-22(30)16-26(25)42-29/h3-17,19H,18H2,1-2H3/b31-17+ |
| InChIKey | HCPMSONJNBSQPY-KBVAKVRCSA-N |
| XLogP | 6.22 |
| TPSA | 139.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.67 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|