C26H25N5O6S2 — CID 44944944
4-(azepan-1-ylsulfonyl)-N-(6-methyl-1,3-benzothiazol-2-yl)-N-[(E)-(5-nitrofuran-2-yl)methylideneamino]benzamide (PubChem CID 44944944) has the molecular formula C26H25N5O6S2 and a molecular weight of 567.65 g/mol. Its IUPAC name is 4-(azepan-1-ylsulfonyl)-N-(6-methyl-1,3-benzothiazol-2-yl)-N-[(E)-(5-nitrofuran-2-yl)methylideneamino]benzamide.
| Compound Name | 4-(azepan-1-ylsulfonyl)-N-(6-methyl-1,3-benzothiazol-2-yl)-N-[(E)-(5-nitrofuran-2-yl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 44944944 |
| Molecular Formula | C26H25N5O6S2 |
| Molecular Weight | 567.65 g/mol |
| Exact Mass | 567.12 |
| IUPAC Name | 4-(azepan-1-ylsulfonyl)-N-(6-methyl-1,3-benzothiazol-2-yl)-N-[(E)-(5-nitrofuran-2-yl)methylideneamino]benzamide |
| SMILES | Cc1ccc2nc(N(/N=C/c3ccc([N+](=O)[O-])o3)C(=O)c3ccc(S(=O)(=O)N4CCCCCC4)cc3)sc2c1 |
| InChI | InChI=1S/C26H25N5O6S2/c1-18-6-12-22-23(16-18)38-26(28-22)30(27-17-20-9-13-24(37-20)31(33)34)25(32)19-7-10-21(11-8-19)39(35,36)29-14-4-2-3-5-15-29/h6-13,16-17H,2-5,14-15H2,1H3/b27-17+ |
| InChIKey | NYLVNCSYUBRYIY-WPWMEQJKSA-N |
| XLogP | 5.35 |
| TPSA | 139.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.65 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|