C19H17FN4O4S — CID 8609144
N-(6-fluoro-1,3-benzothiazol-2-yl)-N-[(5-nitrofuran-2-yl)methylideneamino]cyclohexanecarboxamide (PubChem CID 8609144) has the molecular formula C19H17FN4O4S and a molecular weight of 416.43 g/mol. Its IUPAC name is N-(6-fluoro-1,3-benzothiazol-2-yl)-N-[(5-nitrofuran-2-yl)methylideneamino]cyclohexanecarboxamide.
| Compound Name | N-(6-fluoro-1,3-benzothiazol-2-yl)-N-[(5-nitrofuran-2-yl)methylideneamino]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 8609144 |
| Molecular Formula | C19H17FN4O4S |
| Molecular Weight | 416.43 g/mol |
| Exact Mass | 416.10 |
| IUPAC Name | N-(6-fluoro-1,3-benzothiazol-2-yl)-N-[(5-nitrofuran-2-yl)methylideneamino]cyclohexanecarboxamide |
| SMILES | O=C(C1CCCCC1)N(N=Cc1ccc([N+](=O)[O-])o1)c1nc2ccc(F)cc2s1 |
| InChI | InChI=1S/C19H17FN4O4S/c20-13-6-8-15-16(10-13)29-19(22-15)23(18(25)12-4-2-1-3-5-12)21-11-14-7-9-17(28-14)24(26)27/h6-12H,1-5H2 |
| InChIKey | MGLXCOBWOSRJRN-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 101.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.43 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|