C19H10FN5O6S — CID 44943129
N-(6-fluoro-1,3-benzothiazol-2-yl)-N-[(E)-furan-2-ylmethylideneamino]-3,5-dinitrobenzamide (PubChem CID 44943129) has the molecular formula C19H10FN5O6S and a molecular weight of 455.38 g/mol. Its IUPAC name is N-(6-fluoro-1,3-benzothiazol-2-yl)-N-[(E)-furan-2-ylmethylideneamino]-3,5-dinitrobenzamide.
| Compound Name | N-(6-fluoro-1,3-benzothiazol-2-yl)-N-[(E)-furan-2-ylmethylideneamino]-3,5-dinitrobenzamide |
|---|---|
| PubChem CID | 44943129 |
| Molecular Formula | C19H10FN5O6S |
| Molecular Weight | 455.38 g/mol |
| Exact Mass | 455.03 |
| IUPAC Name | N-(6-fluoro-1,3-benzothiazol-2-yl)-N-[(E)-furan-2-ylmethylideneamino]-3,5-dinitrobenzamide |
| SMILES | O=C(c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1)N(/N=C/c1ccco1)c1nc2ccc(F)cc2s1 |
| InChI | InChI=1S/C19H10FN5O6S/c20-12-3-4-16-17(8-12)32-19(22-16)23(21-10-15-2-1-5-31-15)18(26)11-6-13(24(27)28)9-14(7-11)25(29)30/h1-10H/b21-10+ |
| InChIKey | XVQFVPIOTXDOJG-UFFVCSGVSA-N |
| XLogP | 4.53 |
| TPSA | 144.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.38 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|