C19H12FN3O2S — CID 7543438
N-(6-fluoro-1,3-benzothiazol-2-yl)-N-[(Z)-furan-2-ylmethylideneamino]benzamide (PubChem CID 7543438) has the molecular formula C19H12FN3O2S and a molecular weight of 365.39 g/mol. Its IUPAC name is N-(6-fluoro-1,3-benzothiazol-2-yl)-N-[(Z)-furan-2-ylmethylideneamino]benzamide.
| Compound Name | N-(6-fluoro-1,3-benzothiazol-2-yl)-N-[(Z)-furan-2-ylmethylideneamino]benzamide |
|---|---|
| PubChem CID | 7543438 |
| Molecular Formula | C19H12FN3O2S |
| Molecular Weight | 365.39 g/mol |
| Exact Mass | 365.06 |
| IUPAC Name | N-(6-fluoro-1,3-benzothiazol-2-yl)-N-[(Z)-furan-2-ylmethylideneamino]benzamide |
| SMILES | O=C(c1ccccc1)N(/N=C\c1ccco1)c1nc2ccc(F)cc2s1 |
| InChI | InChI=1S/C19H12FN3O2S/c20-14-8-9-16-17(11-14)26-19(22-16)23(21-12-15-7-4-10-25-15)18(24)13-5-2-1-3-6-13/h1-12H/b21-12- |
| InChIKey | XTNIPOSRWUWOCA-MTJSOVHGSA-N |
| XLogP | 4.71 |
| TPSA | 58.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.39 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|