C20H11F4N3O2S — CID 44943088
N-(6-fluoro-1,3-benzothiazol-2-yl)-N-[(E)-furan-2-ylmethylideneamino]-3-(trifluoromethyl)benzamide (PubChem CID 44943088) has the molecular formula C20H11F4N3O2S and a molecular weight of 433.39 g/mol. Its IUPAC name is N-(6-fluoro-1,3-benzothiazol-2-yl)-N-[(E)-furan-2-ylmethylideneamino]-3-(trifluoromethyl)benzamide.
| Compound Name | N-(6-fluoro-1,3-benzothiazol-2-yl)-N-[(E)-furan-2-ylmethylideneamino]-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 44943088 |
| Molecular Formula | C20H11F4N3O2S |
| Molecular Weight | 433.39 g/mol |
| Exact Mass | 433.05 |
| IUPAC Name | N-(6-fluoro-1,3-benzothiazol-2-yl)-N-[(E)-furan-2-ylmethylideneamino]-3-(trifluoromethyl)benzamide |
| SMILES | O=C(c1cccc(C(F)(F)F)c1)N(/N=C/c1ccco1)c1nc2ccc(F)cc2s1 |
| InChI | InChI=1S/C20H11F4N3O2S/c21-14-6-7-16-17(10-14)30-19(26-16)27(25-11-15-5-2-8-29-15)18(28)12-3-1-4-13(9-12)20(22,23)24/h1-11H/b25-11+ |
| InChIKey | UTKRWFQNYVPALC-OPEKNORGSA-N |
| XLogP | 5.73 |
| TPSA | 58.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.39 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|