C21H14BrN3O4S — CID 44941859
N-(6-bromo-1,3-benzothiazol-2-yl)-N-[(E)-furan-2-ylmethylideneamino]-2,3-dihydro-1,4-benzodioxine-6-carboxamide (PubChem CID 44941859) has the molecular formula C21H14BrN3O4S and a molecular weight of 484.33 g/mol. Its IUPAC name is N-(6-bromo-1,3-benzothiazol-2-yl)-N-[(E)-furan-2-ylmethylideneamino]-2,3-dihydro-1,4-benzodioxine-6-carboxamide.
| Compound Name | N-(6-bromo-1,3-benzothiazol-2-yl)-N-[(E)-furan-2-ylmethylideneamino]-2,3-dihydro-1,4-benzodioxine-6-carboxamide |
|---|---|
| PubChem CID | 44941859 |
| Molecular Formula | C21H14BrN3O4S |
| Molecular Weight | 484.33 g/mol |
| Exact Mass | 482.99 |
| IUPAC Name | N-(6-bromo-1,3-benzothiazol-2-yl)-N-[(E)-furan-2-ylmethylideneamino]-2,3-dihydro-1,4-benzodioxine-6-carboxamide |
| SMILES | O=C(c1ccc2c(c1)OCCO2)N(/N=C/c1ccco1)c1nc2ccc(Br)cc2s1 |
| InChI | InChI=1S/C21H14BrN3O4S/c22-14-4-5-16-19(11-14)30-21(24-16)25(23-12-15-2-1-7-27-15)20(26)13-3-6-17-18(10-13)29-9-8-28-17/h1-7,10-12H,8-9H2/b23-12+ |
| InChIKey | WUWSUBFFSUHUJU-FSJBWODESA-N |
| XLogP | 5.10 |
| TPSA | 77.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.33 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|