C21H14N4O2S2 — CID 44944340
N-[(E)-furan-2-ylmethylideneamino]-N-(6-methyl-1,3-benzothiazol-2-yl)-1,3-benzothiazole-6-carboxamide (PubChem CID 44944340) has the molecular formula C21H14N4O2S2 and a molecular weight of 418.50 g/mol. Its IUPAC name is N-[(E)-furan-2-ylmethylideneamino]-N-(6-methyl-1,3-benzothiazol-2-yl)-1,3-benzothiazole-6-carboxamide.
| Compound Name | N-[(E)-furan-2-ylmethylideneamino]-N-(6-methyl-1,3-benzothiazol-2-yl)-1,3-benzothiazole-6-carboxamide |
|---|---|
| PubChem CID | 44944340 |
| Molecular Formula | C21H14N4O2S2 |
| Molecular Weight | 418.50 g/mol |
| Exact Mass | 418.06 |
| IUPAC Name | N-[(E)-furan-2-ylmethylideneamino]-N-(6-methyl-1,3-benzothiazol-2-yl)-1,3-benzothiazole-6-carboxamide |
| SMILES | Cc1ccc2nc(N(/N=C/c3ccco3)C(=O)c3ccc4ncsc4c3)sc2c1 |
| InChI | InChI=1S/C21H14N4O2S2/c1-13-4-6-17-19(9-13)29-21(24-17)25(23-11-15-3-2-8-27-15)20(26)14-5-7-16-18(10-14)28-12-22-16/h2-12H,1H3/b23-11+ |
| InChIKey | HVLIRBOQDFHCIY-FOKLQQMPSA-N |
| XLogP | 5.49 |
| TPSA | 71.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.50 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|