C24H18N4O2S2 — CID 44945739
N-(6-methoxy-1,3-benzothiazol-2-yl)-N-[(E)-(4-methylphenyl)methylideneamino]-1,3-benzothiazole-6-carboxamide (PubChem CID 44945739) has the molecular formula C24H18N4O2S2 and a molecular weight of 458.57 g/mol. Its IUPAC name is N-(6-methoxy-1,3-benzothiazol-2-yl)-N-[(E)-(4-methylphenyl)methylideneamino]-1,3-benzothiazole-6-carboxamide.
| Compound Name | N-(6-methoxy-1,3-benzothiazol-2-yl)-N-[(E)-(4-methylphenyl)methylideneamino]-1,3-benzothiazole-6-carboxamide |
|---|---|
| PubChem CID | 44945739 |
| Molecular Formula | C24H18N4O2S2 |
| Molecular Weight | 458.57 g/mol |
| Exact Mass | 458.09 |
| IUPAC Name | N-(6-methoxy-1,3-benzothiazol-2-yl)-N-[(E)-(4-methylphenyl)methylideneamino]-1,3-benzothiazole-6-carboxamide |
| SMILES | COc1ccc2nc(N(/N=C/c3ccc(C)cc3)C(=O)c3ccc4ncsc4c3)sc2c1 |
| InChI | InChI=1S/C24H18N4O2S2/c1-15-3-5-16(6-4-15)13-26-28(23(29)17-7-9-19-21(11-17)31-14-25-19)24-27-20-10-8-18(30-2)12-22(20)32-24/h3-14H,1-2H3/b26-13+ |
| InChIKey | OYQQCEYPBCUCAQ-LGJNPRDNSA-N |
| XLogP | 5.90 |
| TPSA | 67.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.57 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|