C22H18BrN3O5S — CID 44941819
N-(6-bromo-1,3-benzothiazol-2-yl)-N-[(E)-furan-2-ylmethylideneamino]-3,4,5-trimethoxybenzamide (PubChem CID 44941819) has the molecular formula C22H18BrN3O5S and a molecular weight of 516.37 g/mol. Its IUPAC name is N-(6-bromo-1,3-benzothiazol-2-yl)-N-[(E)-furan-2-ylmethylideneamino]-3,4,5-trimethoxybenzamide.
| Compound Name | N-(6-bromo-1,3-benzothiazol-2-yl)-N-[(E)-furan-2-ylmethylideneamino]-3,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 44941819 |
| Molecular Formula | C22H18BrN3O5S |
| Molecular Weight | 516.37 g/mol |
| Exact Mass | 515.02 |
| IUPAC Name | N-(6-bromo-1,3-benzothiazol-2-yl)-N-[(E)-furan-2-ylmethylideneamino]-3,4,5-trimethoxybenzamide |
| SMILES | COc1cc(C(=O)N(/N=C/c2ccco2)c2nc3ccc(Br)cc3s2)cc(OC)c1OC |
| InChI | InChI=1S/C22H18BrN3O5S/c1-28-17-9-13(10-18(29-2)20(17)30-3)21(27)26(24-12-15-5-4-8-31-15)22-25-16-7-6-14(23)11-19(16)32-22/h4-12H,1-3H3/b24-12+ |
| InChIKey | ZLWQTPZHYBZHOK-WYMPLXKRSA-N |
| XLogP | 5.36 |
| TPSA | 86.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.37 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|