C22H12BrN3O4S — CID 44941845
N-(6-bromo-1,3-benzothiazol-2-yl)-N-[(E)-furan-2-ylmethylideneamino]-2-oxochromene-3-carboxamide (PubChem CID 44941845) has the molecular formula C22H12BrN3O4S and a molecular weight of 494.33 g/mol. Its IUPAC name is N-(6-bromo-1,3-benzothiazol-2-yl)-N-[(E)-furan-2-ylmethylideneamino]-2-oxochromene-3-carboxamide.
| Compound Name | N-(6-bromo-1,3-benzothiazol-2-yl)-N-[(E)-furan-2-ylmethylideneamino]-2-oxochromene-3-carboxamide |
|---|---|
| PubChem CID | 44941845 |
| Molecular Formula | C22H12BrN3O4S |
| Molecular Weight | 494.33 g/mol |
| Exact Mass | 492.97 |
| IUPAC Name | N-(6-bromo-1,3-benzothiazol-2-yl)-N-[(E)-furan-2-ylmethylideneamino]-2-oxochromene-3-carboxamide |
| SMILES | O=C(c1cc2ccccc2oc1=O)N(/N=C/c1ccco1)c1nc2ccc(Br)cc2s1 |
| InChI | InChI=1S/C22H12BrN3O4S/c23-14-7-8-17-19(11-14)31-22(25-17)26(24-12-15-5-3-9-29-15)20(27)16-10-13-4-1-2-6-18(13)30-21(16)28/h1-12H/b24-12+ |
| InChIKey | XRCXKNHJRAZXSA-WYMPLXKRSA-N |
| XLogP | 5.44 |
| TPSA | 88.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.33 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|