C27H17N3O5S — CID 44945530
N-[(E)-furan-2-ylmethylideneamino]-N-(6-methoxy-1,3-benzothiazol-2-yl)-3-oxobenzo[f]chromene-2-carboxamide (PubChem CID 44945530) has the molecular formula C27H17N3O5S and a molecular weight of 495.52 g/mol. Its IUPAC name is N-[(E)-furan-2-ylmethylideneamino]-N-(6-methoxy-1,3-benzothiazol-2-yl)-3-oxobenzo[f]chromene-2-carboxamide.
| Compound Name | N-[(E)-furan-2-ylmethylideneamino]-N-(6-methoxy-1,3-benzothiazol-2-yl)-3-oxobenzo[f]chromene-2-carboxamide |
|---|---|
| PubChem CID | 44945530 |
| Molecular Formula | C27H17N3O5S |
| Molecular Weight | 495.52 g/mol |
| Exact Mass | 495.09 |
| IUPAC Name | N-[(E)-furan-2-ylmethylideneamino]-N-(6-methoxy-1,3-benzothiazol-2-yl)-3-oxobenzo[f]chromene-2-carboxamide |
| SMILES | COc1ccc2nc(N(/N=C/c3ccco3)C(=O)c3cc4c(ccc5ccccc54)oc3=O)sc2c1 |
| InChI | InChI=1S/C27H17N3O5S/c1-33-17-9-10-22-24(13-17)36-27(29-22)30(28-15-18-6-4-12-34-18)25(31)21-14-20-19-7-3-2-5-16(19)8-11-23(20)35-26(21)32/h2-15H,1H3/b28-15+ |
| InChIKey | BCTOROKBHDEKNS-RWPZCVJISA-N |
| XLogP | 5.84 |
| TPSA | 98.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.52 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|