C26H19N3O4S — CID 44944763
N-[(E)-(4-methoxyphenyl)methylideneamino]-N-(6-methyl-1,3-benzothiazol-2-yl)-2-oxochromene-3-carboxamide (PubChem CID 44944763) has the molecular formula C26H19N3O4S and a molecular weight of 469.52 g/mol. Its IUPAC name is N-[(E)-(4-methoxyphenyl)methylideneamino]-N-(6-methyl-1,3-benzothiazol-2-yl)-2-oxochromene-3-carboxamide.
| Compound Name | N-[(E)-(4-methoxyphenyl)methylideneamino]-N-(6-methyl-1,3-benzothiazol-2-yl)-2-oxochromene-3-carboxamide |
|---|---|
| PubChem CID | 44944763 |
| Molecular Formula | C26H19N3O4S |
| Molecular Weight | 469.52 g/mol |
| Exact Mass | 469.11 |
| IUPAC Name | N-[(E)-(4-methoxyphenyl)methylideneamino]-N-(6-methyl-1,3-benzothiazol-2-yl)-2-oxochromene-3-carboxamide |
| SMILES | COc1ccc(/C=N/N(C(=O)c2cc3ccccc3oc2=O)c2nc3ccc(C)cc3s2)cc1 |
| InChI | InChI=1S/C26H19N3O4S/c1-16-7-12-21-23(13-16)34-26(28-21)29(27-15-17-8-10-19(32-2)11-9-17)24(30)20-14-18-5-3-4-6-22(18)33-25(20)31/h3-15H,1-2H3/b27-15+ |
| InChIKey | JCUMSMIEZODKGW-JFLMPSFJSA-N |
| XLogP | 5.40 |
| TPSA | 85.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.52 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|