C26H19BrN4O4S2 — CID 44941870
N-(6-bromo-1,3-benzothiazol-2-yl)-N-[(E)-furan-2-ylmethylideneamino]-4-[methyl(phenyl)sulfamoyl]benzamide (PubChem CID 44941870) has the molecular formula C26H19BrN4O4S2 and a molecular weight of 595.50 g/mol. Its IUPAC name is N-(6-bromo-1,3-benzothiazol-2-yl)-N-[(E)-furan-2-ylmethylideneamino]-4-[methyl(phenyl)sulfamoyl]benzamide.
| Compound Name | N-(6-bromo-1,3-benzothiazol-2-yl)-N-[(E)-furan-2-ylmethylideneamino]-4-[methyl(phenyl)sulfamoyl]benzamide |
|---|---|
| PubChem CID | 44941870 |
| Molecular Formula | C26H19BrN4O4S2 |
| Molecular Weight | 595.50 g/mol |
| Exact Mass | 594.00 |
| IUPAC Name | N-(6-bromo-1,3-benzothiazol-2-yl)-N-[(E)-furan-2-ylmethylideneamino]-4-[methyl(phenyl)sulfamoyl]benzamide |
| SMILES | CN(c1ccccc1)S(=O)(=O)c1ccc(C(=O)N(/N=C/c2ccco2)c2nc3ccc(Br)cc3s2)cc1 |
| InChI | InChI=1S/C26H19BrN4O4S2/c1-30(20-6-3-2-4-7-20)37(33,34)22-12-9-18(10-13-22)25(32)31(28-17-21-8-5-15-35-21)26-29-23-14-11-19(27)16-24(23)36-26/h2-17H,1H3/b28-17+ |
| InChIKey | VAXKGAKMNVLHPT-OGLMXYFKSA-N |
| XLogP | 6.16 |
| TPSA | 96.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.50 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|