C25H19BrF3N3O4S — CID 44941740
N-(6-bromo-1,3-benzothiazol-2-yl)-3-(trifluoromethyl)-N-[(E)-(3,4,5-trimethoxyphenyl)methylideneamino]benzamide (PubChem CID 44941740) has the molecular formula C25H19BrF3N3O4S and a molecular weight of 594.41 g/mol. Its IUPAC name is N-(6-bromo-1,3-benzothiazol-2-yl)-3-(trifluoromethyl)-N-[(E)-(3,4,5-trimethoxyphenyl)methylideneamino]benzamide.
| Compound Name | N-(6-bromo-1,3-benzothiazol-2-yl)-3-(trifluoromethyl)-N-[(E)-(3,4,5-trimethoxyphenyl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 44941740 |
| Molecular Formula | C25H19BrF3N3O4S |
| Molecular Weight | 594.41 g/mol |
| Exact Mass | 593.02 |
| IUPAC Name | N-(6-bromo-1,3-benzothiazol-2-yl)-3-(trifluoromethyl)-N-[(E)-(3,4,5-trimethoxyphenyl)methylideneamino]benzamide |
| SMILES | COc1cc(/C=N/N(C(=O)c2cccc(C(F)(F)F)c2)c2nc3ccc(Br)cc3s2)cc(OC)c1OC |
| InChI | InChI=1S/C25H19BrF3N3O4S/c1-34-19-9-14(10-20(35-2)22(19)36-3)13-30-32(24-31-18-8-7-17(26)12-21(18)37-24)23(33)15-5-4-6-16(11-15)25(27,28)29/h4-13H,1-3H3/b30-13+ |
| InChIKey | WNXWANRCWXLMII-VVEOGCPPSA-N |
| XLogP | 6.78 |
| TPSA | 73.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.41 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|