C23H15BrF3N3OS — CID 44942028
N-(6-bromo-1,3-benzothiazol-2-yl)-N-[(E)-(4-methylphenyl)methylideneamino]-3-(trifluoromethyl)benzamide (PubChem CID 44942028) has the molecular formula C23H15BrF3N3OS and a molecular weight of 518.36 g/mol. Its IUPAC name is N-(6-bromo-1,3-benzothiazol-2-yl)-N-[(E)-(4-methylphenyl)methylideneamino]-3-(trifluoromethyl)benzamide.
| Compound Name | N-(6-bromo-1,3-benzothiazol-2-yl)-N-[(E)-(4-methylphenyl)methylideneamino]-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 44942028 |
| Molecular Formula | C23H15BrF3N3OS |
| Molecular Weight | 518.36 g/mol |
| Exact Mass | 517.01 |
| IUPAC Name | N-(6-bromo-1,3-benzothiazol-2-yl)-N-[(E)-(4-methylphenyl)methylideneamino]-3-(trifluoromethyl)benzamide |
| SMILES | Cc1ccc(/C=N/N(C(=O)c2cccc(C(F)(F)F)c2)c2nc3ccc(Br)cc3s2)cc1 |
| InChI | InChI=1S/C23H15BrF3N3OS/c1-14-5-7-15(8-6-14)13-28-30(22-29-19-10-9-18(24)12-20(19)32-22)21(31)16-3-2-4-17(11-16)23(25,26)27/h2-13H,1H3/b28-13+ |
| InChIKey | CUVUTVZNVRNVFW-XODNFHPESA-N |
| XLogP | 7.07 |
| TPSA | 45.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.36 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|